CAS 1384428-03-8 appears in our catalog under these names: 1-(Cyclopropylsulfonyl)piperidin-4-amine hydrochloride, 98+%, 1-(Cyclopropanesulfonyl)piperidin-4-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
1-cyclopropylsulfonylpiperidin-4-amine;hydrochloride (CAS 1384428-03-8) is a chemical compound with the molecular formula C8H17ClN2O2S and a molecular weight of 240.75 g/mol. IUPAC name: 1-cyclopropylsulfonylpiperidin-4-amine;hydrochloride. InChIKey: PTFJUUCTOVLAEX-UHFFFAOYSA-N.
| Molecular formula | C8H17ClN2O2S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | 1-cyclopropylsulfonylpiperidin-4-amine;hydrochloride |
| InChIKey | PTFJUUCTOVLAEX-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)N2CCC(CC2)N.Cl |
Computed by PubChem (NCBI)