Products 2038758-35-7
CAS 2038758-35-7 is the registry number for N-(8-Azabicyclo[3.2.1]octan-3-yl)methanesulfonamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(8-azabicyclo[3.2.1]octan-3-yl)methanesulfonamide;hydrochloride (CAS 2038758-35-7) is a chemical compound with the molecular formula C8H17ClN2O2S and a molecular weight of 240.75 g/mol. IUPAC name: N-(8-azabicyclo[3.2.1]octan-3-yl)methanesulfonamide;hydrochloride. InChIKey: IFKXZTXNBQQJFJ-UHFFFAOYSA-N.
| Molecular formula | C8H17ClN2O2S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | N-(8-azabicyclo[3.2.1]octan-3-yl)methanesulfonamide;hydrochloride |
| InChIKey | IFKXZTXNBQQJFJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1CC2CCC(C1)N2.Cl |
Computed by PubChem (NCBI)