Products 1644381-18-9

CAS 1644381-18-9 is the registry number for 3-(Piperazin-1-yl)tetrahydrothiophene 1,1-dioxide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-piperazin-1-ylthiolane 1,1-dioxide;hydrochloride (CAS 1644381-18-9) is a chemical compound with the molecular formula C8H17ClN2O2S and a molecular weight of 240.75 g/mol. IUPAC name: 3-piperazin-1-ylthiolane 1,1-dioxide;hydrochloride. InChIKey: QYFABGRAQQENFF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17ClN2O2S
Molecular weight240.75 g/mol
IUPAC name3-piperazin-1-ylthiolane 1,1-dioxide;hydrochloride
InChIKeyQYFABGRAQQENFF-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1N2CCNCC2.Cl

Computed by PubChem (NCBI)