CAS 1384429-18-8 appears in our catalog under these names: 4-Cyano-2,6-difluorobenzene-1-sulfonyl chloride, 95%, 4-Cyano-2,6-difluorobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-cyano-2,6-difluorobenzenesulfonyl chloride (CAS 1384429-18-8) is a chemical compound with the molecular formula C7H2ClF2NO2S and a molecular weight of 237.61 g/mol. IUPAC name: 4-cyano-2,6-difluorobenzenesulfonyl chloride. InChIKey: CSFLOEVQKOSHMW-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF2NO2S |
|---|---|
| Molecular weight | 237.61 g/mol |
| IUPAC name | 4-cyano-2,6-difluorobenzenesulfonyl chloride |
| InChIKey | CSFLOEVQKOSHMW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)S(=O)(=O)Cl)F)C#N |
Computed by PubChem (NCBI)