Products 1807241-08-2
CAS 1807241-08-2 is the registry number for 5-Cyano-2,4-difluorobenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-cyano-2,4-difluorobenzenesulfonyl chloride (CAS 1807241-08-2) is a chemical compound with the molecular formula C7H2ClF2NO2S and a molecular weight of 237.61 g/mol. IUPAC name: 5-cyano-2,4-difluorobenzenesulfonyl chloride. InChIKey: IXAUXSJHQQNJQI-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF2NO2S |
|---|---|
| Molecular weight | 237.61 g/mol |
| IUPAC name | 5-cyano-2,4-difluorobenzenesulfonyl chloride |
| InChIKey | IXAUXSJHQQNJQI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)F)F)C#N |
Computed by PubChem (NCBI)