Products 1807155-56-1

CAS 1807155-56-1 is the registry number for 2-Cyano-4,5-difluorobenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-cyano-4,5-difluorobenzenesulfonyl chloride (CAS 1807155-56-1) is a chemical compound with the molecular formula C7H2ClF2NO2S and a molecular weight of 237.61 g/mol. IUPAC name: 2-cyano-4,5-difluorobenzenesulfonyl chloride. InChIKey: INOWRNVVIYSLAR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H2ClF2NO2S
Molecular weight237.61 g/mol
IUPAC name2-cyano-4,5-difluorobenzenesulfonyl chloride
InChIKeyINOWRNVVIYSLAR-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1F)F)S(=O)(=O)Cl)C#N

Computed by PubChem (NCBI)