CAS 1384429-33-7 is the registry number for 2-(1H-1,2,3,4-Tetrazol-5-ylmethyl)pyridine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2H-tetrazol-5-ylmethyl)pyridine;dihydrochloride (CAS 1384429-33-7) is a chemical compound with the molecular formula C7H9Cl2N5 and a molecular weight of 234.08 g/mol. IUPAC name: 2-(2H-tetrazol-5-ylmethyl)pyridine;dihydrochloride. InChIKey: HQJKEJDBKRFECI-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N5 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 2-(2H-tetrazol-5-ylmethyl)pyridine;dihydrochloride |
| InChIKey | HQJKEJDBKRFECI-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CC2=NNN=N2.Cl.Cl |
Computed by PubChem (NCBI)