CAS 1384429-77-9 is the registry number for 5-Fluoro-2-(2,2,2-trifluoroethoxy)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 10g, 1g.
5-fluoro-2-(2,2,2-trifluoroethoxy)aniline;hydrochloride (CAS 1384429-77-9) is a chemical compound with the molecular formula C8H8ClF4NO and a molecular weight of 245.60 g/mol. IUPAC name: 5-fluoro-2-(2,2,2-trifluoroethoxy)aniline;hydrochloride. InChIKey: ULYXHGWMPODWIN-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF4NO |
|---|---|
| Molecular weight | 245.60 g/mol |
| IUPAC name | 5-fluoro-2-(2,2,2-trifluoroethoxy)aniline;hydrochloride |
| InChIKey | ULYXHGWMPODWIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N)OCC(F)(F)F.Cl |
Computed by PubChem (NCBI)