Products 2690274-23-6
CAS 2690274-23-6 appears in our catalog under these names: (2-Fluoro-4-(trifluoromethoxy)phenyl)methanamine (hydrochloride), 95%, 95%, (2-Fluoro-4-(trifluoromethoxy)phenyl)methanamine (hydrochloride), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
[2-fluoro-4-(trifluoromethoxy)phenyl]methanamine;hydrochloride (CAS 2690274-23-6) is a chemical compound with the molecular formula C8H8ClF4NO and a molecular weight of 245.60 g/mol. IUPAC name: [2-fluoro-4-(trifluoromethoxy)phenyl]methanamine;hydrochloride. InChIKey: KSDBUDQFJWPTKS-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF4NO |
|---|---|
| Molecular weight | 245.60 g/mol |
| IUPAC name | [2-fluoro-4-(trifluoromethoxy)phenyl]methanamine;hydrochloride |
| InChIKey | KSDBUDQFJWPTKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)F)CN.Cl |
Computed by PubChem (NCBI)