CAS 2459963-15-4 appears in our catalog under these names: (2-Fluoro-5-(trifluoromethoxy)phenyl)methanamine hydrochloride, 97%, 1-[2-fluoro-5-(trifluoromethoxy)phenyl]methanamine hydrochloride. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 100mg, 250mg, 500mg, 1g, 5g, 10g.
[2-fluoro-5-(trifluoromethoxy)phenyl]methanamine;hydrochloride (CAS 2459963-15-4) is a chemical compound with the molecular formula C8H8ClF4NO and a molecular weight of 245.60 g/mol. IUPAC name: [2-fluoro-5-(trifluoromethoxy)phenyl]methanamine;hydrochloride. InChIKey: ZBPAFDVBDSNENR-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF4NO |
|---|---|
| Molecular weight | 245.60 g/mol |
| IUPAC name | [2-fluoro-5-(trifluoromethoxy)phenyl]methanamine;hydrochloride |
| InChIKey | ZBPAFDVBDSNENR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)CN)F.Cl |
Computed by PubChem (NCBI)