CAS 1384430-22-1 appears in our catalog under these names: 1-(2-Bromobenzoyl)-1H-indazol-3-amine, 1-(2-Bromobenzoyl)-1H-indazol-3-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
(3-aminoindazol-1-yl)-(2-bromophenyl)methanone (CAS 1384430-22-1) is a chemical compound with the molecular formula C14H10BrN3O and a molecular weight of 316.15 g/mol. IUPAC name: (3-aminoindazol-1-yl)-(2-bromophenyl)methanone. InChIKey: FPVGPUPVGRMIOD-UHFFFAOYSA-N.
| Molecular formula | C14H10BrN3O |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | (3-aminoindazol-1-yl)-(2-bromophenyl)methanone |
| InChIKey | FPVGPUPVGRMIOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2C(=O)C3=CC=CC=C3Br)N |
Computed by PubChem (NCBI)