Products 1384680-90-3
CAS 1384680-90-3 appears in our catalog under these names: 4-(3-Chloro-4-(1-hydroxyethyl)phenyl)piperazin-2-one, 98%, 4-(3-Chloro-4-(1-hydroxyethyl)phenyl)piperazin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[3-chloro-4-(1-hydroxyethyl)phenyl]piperazin-2-one (CAS 1384680-90-3) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 4-[3-chloro-4-(1-hydroxyethyl)phenyl]piperazin-2-one. InChIKey: YCXUOJGDIDJRNP-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 4-[3-chloro-4-(1-hydroxyethyl)phenyl]piperazin-2-one |
| InChIKey | YCXUOJGDIDJRNP-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)N2CCNC(=O)C2)Cl)O |
Computed by PubChem (NCBI)