Products 1385694-53-0
CAS 1385694-53-0 appears in our catalog under these names: 1-(3-bromophenyl)-4-oxo-Cyclohexanecarboxylic acid, ≥95%, ≥95%, 1-(3-BROMOPHENYL)-4-OXOCYCLOHEXANECARBOXYLIC ACID, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-(3-bromophenyl)-4-oxocyclohexane-1-carboxylic acid (CAS 1385694-53-0) is a chemical compound with the molecular formula C13H13BrO3 and a molecular weight of 297.14 g/mol. IUPAC name: 1-(3-bromophenyl)-4-oxocyclohexane-1-carboxylic acid. InChIKey: UCHFVVKRPFIJHT-UHFFFAOYSA-N.
| Molecular formula | C13H13BrO3 |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | 1-(3-bromophenyl)-4-oxocyclohexane-1-carboxylic acid |
| InChIKey | UCHFVVKRPFIJHT-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1=O)(C2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)