CAS 733740-98-2 is the registry number for trans-2-(4-Bromobenzoyl)cyclopentanecarboxylic acid, 98+%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 50mg.
Trans-(1R,2R)-2-(4-bromobenzoyl)cyclopentane-1-carboxylic acid (CAS 733740-98-2) is a chemical compound with the molecular formula C13H13BrO3 and a molecular weight of 297.14 g/mol. IUPAC name: trans-(1R,2R)-2-(4-bromobenzoyl)cyclopentane-1-carboxylic acid. InChIKey: BVTWSRUFFHBCHO-GHMZBOCLSA-N.
| Molecular formula | C13H13BrO3 |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-bromobenzoyl)cyclopentane-1-carboxylic acid |
| InChIKey | BVTWSRUFFHBCHO-GHMZBOCLSA-N |
| SMILES | C1C[C@H]([C@@H](C1)C(=O)O)C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)