Products 733740-98-2

CAS 733740-98-2 is the registry number for trans-2-(4-Bromobenzoyl)cyclopentanecarboxylic acid, 98+%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 50mg.

Trans-(1R,2R)-2-(4-bromobenzoyl)cyclopentane-1-carboxylic acid (CAS 733740-98-2) is a chemical compound with the molecular formula C13H13BrO3 and a molecular weight of 297.14 g/mol. IUPAC name: trans-(1R,2R)-2-(4-bromobenzoyl)cyclopentane-1-carboxylic acid. InChIKey: BVTWSRUFFHBCHO-GHMZBOCLSA-N.

Identity
Molecular formulaC13H13BrO3
Molecular weight297.14 g/mol
IUPAC nametrans-(1R,2R)-2-(4-bromobenzoyl)cyclopentane-1-carboxylic acid
InChIKeyBVTWSRUFFHBCHO-GHMZBOCLSA-N
SMILESC1C[C@H]([C@@H](C1)C(=O)O)C(=O)C2=CC=C(C=C2)Br

Computed by PubChem (NCBI)