CAS 791594-13-3 appears in our catalog under these names: (1R,2R)-2-(4-Bromobenzoyl)cyclopentanecarboxylic acid, 98%, (1R,2R)-2-(4-Bromobenzoyl)cyclopentanecarboxylic acid, 98%, 98%, (1R,2R)-2-(4-Bromobenzoyl)cyclopentane-1-carboxylic acid, 99.25%, (1R,2R)-2-(4-bromobenzoyl)cyclopentane-1-carboxylic acid, 98%. Offered by: AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 25 mg, 250 mg, 100 mg, 50 mg.
Trans-(1R,2R)-2-(4-bromobenzoyl)cyclopentane-1-carboxylic acid (CAS 791594-13-3) is a chemical compound with the molecular formula C13H13BrO3 and a molecular weight of 297.14 g/mol. IUPAC name: trans-(1R,2R)-2-(4-bromobenzoyl)cyclopentane-1-carboxylic acid. InChIKey: BVTWSRUFFHBCHO-GHMZBOCLSA-N.
| Molecular formula | C13H13BrO3 |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-bromobenzoyl)cyclopentane-1-carboxylic acid |
| InChIKey | BVTWSRUFFHBCHO-GHMZBOCLSA-N |
| SMILES | C1C[C@H]([C@@H](C1)C(=O)O)C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)