Products 1385696-86-5

CAS 1385696-86-5 appears in our catalog under these names: 2,7-Diazaspiro(4.5)decan-3-one hydrochloride, 98+%, 2,7–Diazaspiro(4·5)decan–3–one hydrochloride, 2,7-Diazaspiro(4.5)decan-3-one hydrochloride. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 100mg.

2,9-diazaspiro[4.5]decan-3-one;hydrochloride (CAS 1385696-86-5) is a chemical compound with the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. IUPAC name: 2,9-diazaspiro[4.5]decan-3-one;hydrochloride. InChIKey: DEIZDSYWTHMOAV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15ClN2O
Molecular weight190.67 g/mol
IUPAC name2,9-diazaspiro[4.5]decan-3-one;hydrochloride
InChIKeyDEIZDSYWTHMOAV-UHFFFAOYSA-N
SMILESC1CC2(CC(=O)NC2)CNC1.Cl

Computed by PubChem (NCBI)