Products 1385767-85-0

CAS 1385767-85-0 is the registry number for Pyridoxine Impurity 13. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-ethoxy-11-methyl-5-propyl-4,6,12-trioxa-10-azatricyclo[7.2.1.02,8]dodec-10-ene (CAS 1385767-85-0) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 1-ethoxy-11-methyl-5-propyl-4,6,12-trioxa-10-azatricyclo[7.2.1.02,8]dodec-10-ene. InChIKey: GALARBWKLCBLJU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H23NO4
Molecular weight269.34 g/mol
IUPAC name1-ethoxy-11-methyl-5-propyl-4,6,12-trioxa-10-azatricyclo[7.2.1.02,8]dodec-10-ene
InChIKeyGALARBWKLCBLJU-UHFFFAOYSA-N
SMILESCCCC1OCC2C(CO1)C3(C(=NC2O3)C)OCC

Computed by PubChem (NCBI)