CAS 1385789-70-7 appears in our catalog under these names: Teriflunomide Impurity 1, 2-Cyano-3-hydroxy-N-(4-methylphenyl)-2-butenamide. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(E)-2-cyano-3-hydroxy-N-(4-methylphenyl)but-2-enamide (CAS 1385789-70-7) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: (E)-2-cyano-3-hydroxy-N-(4-methylphenyl)but-2-enamide. InChIKey: MKTXCGFXIPYXCR-PKNBQFBNSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | (E)-2-cyano-3-hydroxy-N-(4-methylphenyl)but-2-enamide |
| InChIKey | MKTXCGFXIPYXCR-PKNBQFBNSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)/C(=C(\C)/O)/C#N |
Computed by PubChem (NCBI)