CAS 13866-64-3 is the registry number for N-Methyl-n'-(4-nitrophenyl)urea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-methyl-3-(4-nitrophenyl)urea (CAS 13866-64-3) is a chemical compound with the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. IUPAC name: 1-methyl-3-(4-nitrophenyl)urea. InChIKey: KLRUCOUQQILQEI-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 1-methyl-3-(4-nitrophenyl)urea |
| InChIKey | KLRUCOUQQILQEI-UHFFFAOYSA-N |
| SMILES | CNC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)