Products 138661-03-7
CAS 138661-03-7 appears in our catalog under these names: Furnidipine/ 100%, FURNIDIPINE. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 25 mg.
3-O-methyl 5-O-(oxolan-2-ylmethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 138661-03-7) is a chemical compound with the molecular formula C21H24N2O7 and a molecular weight of 416.4 g/mol. IUPAC name: 3-O-methyl 5-O-(oxolan-2-ylmethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: GGVUNNUOJDGCBK-UHFFFAOYSA-N.
| Molecular formula | C21H24N2O7 |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | 3-O-methyl 5-O-(oxolan-2-ylmethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | GGVUNNUOJDGCBK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCC2CCCO2)C3=CC=CC=C3[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)