CAS 138662-59-6 appears in our catalog under these names: (2R,5S)-5-Hydroxypiperidine-2-carboxylic acid hydrochloride, 97%, (2R,5S)-5-Hydroxypiperidine-2-carboxylic acid hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2R,5S)-5-hydroxypiperidine-2-carboxylic acid;hydrochloride (CAS 138662-59-6) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: (2R,5S)-5-hydroxypiperidine-2-carboxylic acid;hydrochloride. InChIKey: ZWHYCCWEJZJLHW-UYXJWNHNSA-N.
| Molecular formula | C6H12ClNO3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | (2R,5S)-5-hydroxypiperidine-2-carboxylic acid;hydrochloride |
| InChIKey | ZWHYCCWEJZJLHW-UYXJWNHNSA-N |
| SMILES | C1C[C@@H](NC[C@H]1O)C(=O)O.Cl |
Computed by PubChem (NCBI)