CAS 138716-36-6 is the registry number for 5-(2-Fluorophenyl)isoxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(2-fluorophenyl)-1,2-oxazole (CAS 138716-36-6) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 5-(2-fluorophenyl)-1,2-oxazole. InChIKey: MPGCKXHQIAUHAX-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-1,2-oxazole |
| InChIKey | MPGCKXHQIAUHAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=NO2)F |
Computed by PubChem (NCBI)