CAS 1387566-08-6 appears in our catalog under these names: 2–(3–Amino–4–bromophenoxy)–N–methylacetamide, 2-(3-Amino-4-bromophenoxy)-N-methylacetamide, 97%, 97%, 2-(3-Amino-4-bromophenoxy)-N-methylacetamide, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(3-amino-4-bromophenoxy)-N-methylacetamide (CAS 1387566-08-6) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: 2-(3-amino-4-bromophenoxy)-N-methylacetamide. InChIKey: DHBLRGZPKYKVPL-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 2-(3-amino-4-bromophenoxy)-N-methylacetamide |
| InChIKey | DHBLRGZPKYKVPL-UHFFFAOYSA-N |
| SMILES | CNC(=O)COC1=CC(=C(C=C1)Br)N |
Computed by PubChem (NCBI)