Products 138763-26-5
CAS 138763-26-5 is the registry number for Pintulin. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[(3-hydroxyphenyl)methoxy]-4,6-dihydrofuro[3,2-c]pyran-2-one (CAS 138763-26-5) is a chemical compound with the molecular formula C14H12O5 and a molecular weight of 260.24 g/mol. IUPAC name: 6-[(3-hydroxyphenyl)methoxy]-4,6-dihydrofuro[3,2-c]pyran-2-one. InChIKey: ZDTFYABNHWHUNO-UHFFFAOYSA-N.
| Molecular formula | C14H12O5 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 6-[(3-hydroxyphenyl)methoxy]-4,6-dihydrofuro[3,2-c]pyran-2-one |
| InChIKey | ZDTFYABNHWHUNO-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=O)OC2=CC(O1)OCC3=CC(=CC=C3)O |
Computed by PubChem (NCBI)