CAS 887354-66-7 appears in our catalog under these names: 1-(2,4-Dihydroxyphenyl)-2-(3,4-dihydroxyphenyl)ethan-1-one, 98%, (1-(2,4-Dihydroxyphenyl)-2-(3’,4’-dihydroxyphenyl)ethanone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
1-(2,4-dihydroxyphenyl)-2-(3,4-dihydroxyphenyl)ethanone (CAS 887354-66-7) is a chemical compound with the molecular formula C14H12O5 and a molecular weight of 260.24 g/mol. IUPAC name: 1-(2,4-dihydroxyphenyl)-2-(3,4-dihydroxyphenyl)ethanone. InChIKey: HYSCQSOORVAXEH-UHFFFAOYSA-N.
| Molecular formula | C14H12O5 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 1-(2,4-dihydroxyphenyl)-2-(3,4-dihydroxyphenyl)ethanone |
| InChIKey | HYSCQSOORVAXEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)C2=C(C=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)