Products 104794-31-2

CAS 104794-31-2 is the registry number for 4-(1,3-Benzodioxol-5-yl)-2,5-dimethyl-3-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(1,3-benzodioxol-5-yl)-2,5-dimethylfuran-3-carboxylic acid (CAS 104794-31-2) is a chemical compound with the molecular formula C14H12O5 and a molecular weight of 260.24 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-yl)-2,5-dimethylfuran-3-carboxylic acid. InChIKey: RSEINJSAVLFFNE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12O5
Molecular weight260.24 g/mol
IUPAC name4-(1,3-benzodioxol-5-yl)-2,5-dimethylfuran-3-carboxylic acid
InChIKeyRSEINJSAVLFFNE-UHFFFAOYSA-N
SMILESCC1=C(C(=C(O1)C)C(=O)O)C2=CC3=C(C=C2)OCO3

Computed by PubChem (NCBI)