CAS 104794-31-2 is the registry number for 4-(1,3-Benzodioxol-5-yl)-2,5-dimethyl-3-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(1,3-benzodioxol-5-yl)-2,5-dimethylfuran-3-carboxylic acid (CAS 104794-31-2) is a chemical compound with the molecular formula C14H12O5 and a molecular weight of 260.24 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-yl)-2,5-dimethylfuran-3-carboxylic acid. InChIKey: RSEINJSAVLFFNE-UHFFFAOYSA-N.
| Molecular formula | C14H12O5 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 4-(1,3-benzodioxol-5-yl)-2,5-dimethylfuran-3-carboxylic acid |
| InChIKey | RSEINJSAVLFFNE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(O1)C)C(=O)O)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)