Products 138786-65-9
CAS 138786-65-9 appears in our catalog under these names: Methyl 2-(bromomethyl)-5-fluorobenzoate, 97%, Methyl 2-(bromomethyl)-5-fluorobenzoate 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
Methyl 2-(bromomethyl)-5-fluorobenzoate (CAS 138786-65-9) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: methyl 2-(bromomethyl)-5-fluorobenzoate. InChIKey: MWSNENBHAODEGV-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | methyl 2-(bromomethyl)-5-fluorobenzoate |
| InChIKey | MWSNENBHAODEGV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)F)CBr |
Computed by PubChem (NCBI)