CAS 1388038-76-3 is the registry number for 4-Chloro-2-hydrazinylbenzoic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 1g.
Methyl 4-chloro-2-hydrazinylbenzoate (CAS 1388038-76-3) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: methyl 4-chloro-2-hydrazinylbenzoate. InChIKey: SWHPXQYPIDASKR-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | methyl 4-chloro-2-hydrazinylbenzoate |
| InChIKey | SWHPXQYPIDASKR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Cl)NN |
Computed by PubChem (NCBI)