Products 1388085-06-0
CAS 1388085-06-0 is the registry number for (R)-1-(4-(tert-Butoxy)phenyl)-2,2-dimethylpropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2,2-dimethyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-1-amine (CAS 1388085-06-0) is a chemical compound with the molecular formula C15H25NO and a molecular weight of 235.36 g/mol. IUPAC name: (1R)-2,2-dimethyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-1-amine. InChIKey: UFSRUFNTKNWTCO-ZDUSSCGKSA-N.
| Molecular formula | C15H25NO |
|---|---|
| Molecular weight | 235.36 g/mol |
| IUPAC name | (1R)-2,2-dimethyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-1-amine |
| InChIKey | UFSRUFNTKNWTCO-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)[C@H](C1=CC=C(C=C1)OC(C)(C)C)N |
Computed by PubChem (NCBI)