CAS 809282-12-0 is the registry number for (1S,2S)-Tapentadol-O-Methyl. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine (CAS 809282-12-0) is a chemical compound with the molecular formula C15H25NO and a molecular weight of 235.36 g/mol. IUPAC name: (2S,3S)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine. InChIKey: JKVBTSJLQLSTHJ-DOMZBBRYSA-N.
| Molecular formula | C15H25NO |
|---|---|
| Molecular weight | 235.36 g/mol |
| IUPAC name | (2S,3S)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine |
| InChIKey | JKVBTSJLQLSTHJ-DOMZBBRYSA-N |
| SMILES | CC[C@H](C1=CC(=CC=C1)OC)[C@H](C)CN(C)C |
Computed by PubChem (NCBI)