CAS 809282-47-1 appears in our catalog under these names: (1S,2R)-Tapentadol-O-Methyl, (BetaR,GammaS)-Gamma-Ethyl-3-methoxy-N,N,Beta-trimethylbenzenepropanamine, (bR,gammaS)-gamma-Ethyl-3-methoxy-N,N,b-trimethylbenzenepropanamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.
(2R,3S)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine (CAS 809282-47-1) is a chemical compound with the molecular formula C15H25NO and a molecular weight of 235.36 g/mol. IUPAC name: (2R,3S)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine. InChIKey: JKVBTSJLQLSTHJ-WFASDCNBSA-N.
| Molecular formula | C15H25NO |
|---|---|
| Molecular weight | 235.36 g/mol |
| IUPAC name | (2R,3S)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine |
| InChIKey | JKVBTSJLQLSTHJ-WFASDCNBSA-N |
| SMILES | CC[C@H](C1=CC(=CC=C1)OC)[C@@H](C)CN(C)C |
Computed by PubChem (NCBI)