CAS 1388214-89-8 is the registry number for 2-(4-(N-Hydroxycarbamimidoyl)phenyl)-2-methylpropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-methylpropanamide (CAS 1388214-89-8) is a chemical compound with the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. IUPAC name: 2-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-methylpropanamide. InChIKey: QQARNGBPWGPFNH-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O2 |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | 2-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-methylpropanamide |
| InChIKey | QQARNGBPWGPFNH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C(=NO)N)C(=O)N |
Computed by PubChem (NCBI)