CAS 38678-61-4 is the registry number for H-Phe-gly-nh2 hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
(2S)-2-amino-N-(2-amino-2-oxoethyl)-3-phenylpropanamide (CAS 38678-61-4) is a chemical compound with the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. IUPAC name: (2S)-2-amino-N-(2-amino-2-oxoethyl)-3-phenylpropanamide. InChIKey: PVHDTHVQHUWCCI-VIFPVBQESA-N.
| Molecular formula | C11H15N3O2 |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | (2S)-2-amino-N-(2-amino-2-oxoethyl)-3-phenylpropanamide |
| InChIKey | PVHDTHVQHUWCCI-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NCC(=O)N)N |
Computed by PubChem (NCBI)