CAS 1510-04-9 appears in our catalog under these names: H-Gly-phe-nh2 hydrochloride, 95%, H–Gly–Phe–NH₂. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 25g, 5g.
(2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanamide (CAS 1510-04-9) is a chemical compound with the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. IUPAC name: (2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanamide. InChIKey: PSPZOKPNYCSKSW-VIFPVBQESA-N.
| Molecular formula | C11H15N3O2 |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | (2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanamide |
| InChIKey | PSPZOKPNYCSKSW-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N)NC(=O)CN |
Computed by PubChem (NCBI)