Products 1388628-76-9
CAS 1388628-76-9 is the registry number for tert–Butyl (6–bromonaphthalen–2–yl)(methyl)carbamate. Offered by: GLPBio. Available pack sizes: 100mg.
Tert-butyl N-(6-bromonaphthalen-2-yl)-N-methylcarbamate (CAS 1388628-76-9) is a chemical compound with the molecular formula C16H18BrNO2 and a molecular weight of 336.22 g/mol. IUPAC name: tert-butyl N-(6-bromonaphthalen-2-yl)-N-methylcarbamate. InChIKey: FTQHWQRCXURCHD-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO2 |
|---|---|
| Molecular weight | 336.22 g/mol |
| IUPAC name | tert-butyl N-(6-bromonaphthalen-2-yl)-N-methylcarbamate |
| InChIKey | FTQHWQRCXURCHD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)