CAS 1397274-79-1 is the registry number for 1-Bromo-6-propyl-2-naphthalenyl Ester N,N-Dimethylcarbamic Acid. Offered by: TRC. Available pack sizes: 500mg.
(1-bromo-6-propylnaphthalen-2-yl) N,N-dimethylcarbamate (CAS 1397274-79-1) is a chemical compound with the molecular formula C16H18BrNO2 and a molecular weight of 336.22 g/mol. IUPAC name: (1-bromo-6-propylnaphthalen-2-yl) N,N-dimethylcarbamate. InChIKey: AFPQAZWPWWDPDR-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO2 |
|---|---|
| Molecular weight | 336.22 g/mol |
| IUPAC name | (1-bromo-6-propylnaphthalen-2-yl) N,N-dimethylcarbamate |
| InChIKey | AFPQAZWPWWDPDR-UHFFFAOYSA-N |
| SMILES | CCCC1=CC2=C(C=C1)C(=C(C=C2)OC(=O)N(C)C)Br |
Computed by PubChem (NCBI)