Products 2512196-54-0
CAS 2512196-54-0 is the registry number for 1-(6-Bromonaphthalen-2-yl)-2-((1-hydroxy-2-methylpropan-2-yl)amino)ethanone. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
1-(6-bromonaphthalen-2-yl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]ethanone (CAS 2512196-54-0) is a chemical compound with the molecular formula C16H18BrNO2 and a molecular weight of 336.22 g/mol. IUPAC name: 1-(6-bromonaphthalen-2-yl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]ethanone. InChIKey: XCWGNQLACQBFKU-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO2 |
|---|---|
| Molecular weight | 336.22 g/mol |
| IUPAC name | 1-(6-bromonaphthalen-2-yl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]ethanone |
| InChIKey | XCWGNQLACQBFKU-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)NCC(=O)C1=CC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)