CAS 138865-23-3 is the registry number for (S)-(+)-2,3-Dihydro-1h-pyrrolo[2,1-c][1,4]benzodiazepine-5,11(10h,11ah)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (CAS 138865-23-3) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione. InChIKey: MXBNEEHQIDLPLQ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| InChIKey | MXBNEEHQIDLPLQ-UHFFFAOYSA-N |
| SMILES | C1CC2C(=O)NC3=CC=CC=C3C(=O)N2C1 |
Computed by PubChem (NCBI)