CAS 1388851-64-6 is the registry number for (1R,2S)-2-(4-Fluorophenyl)cyclopentan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2S)-2-(4-fluorophenyl)cyclopentan-1-amine (CAS 1388851-64-6) is a chemical compound with the molecular formula C11H14FN and a molecular weight of 179.23 g/mol. IUPAC name: trans-(1R,2S)-2-(4-fluorophenyl)cyclopentan-1-amine. InChIKey: SBIOJANZHQTSRP-WDEREUQCSA-N.
| Molecular formula | C11H14FN |
|---|---|
| Molecular weight | 179.23 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-fluorophenyl)cyclopentan-1-amine |
| InChIKey | SBIOJANZHQTSRP-WDEREUQCSA-N |
| SMILES | C1C[C@H]([C@@H](C1)N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)