CAS 1389858-66-5 is the registry number for (1S,2S)-2-(4-Fluorophenyl)cyclopentan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1S,2S)-2-(4-fluorophenyl)cyclopentan-1-amine (CAS 1389858-66-5) is a chemical compound with the molecular formula C11H14FN and a molecular weight of 179.23 g/mol. IUPAC name: cis-(1S,2S)-2-(4-fluorophenyl)cyclopentan-1-amine. InChIKey: SBIOJANZHQTSRP-QWRGUYRKSA-N.
| Molecular formula | C11H14FN |
|---|---|
| Molecular weight | 179.23 g/mol |
| IUPAC name | cis-(1S,2S)-2-(4-fluorophenyl)cyclopentan-1-amine |
| InChIKey | SBIOJANZHQTSRP-QWRGUYRKSA-N |
| SMILES | C1C[C@H]([C@H](C1)N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)