CAS 138923-03-2 appears in our catalog under these names: (1S,4R)-Methyl 4-aminocyclopent-2-enecarboxylate, 95%, Methyl (1S,4R)–4–aminocyclopent–2–ene–1–carboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
Methyl (1S,4R)-4-aminocyclopent-2-ene-1-carboxylate (CAS 138923-03-2) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. IUPAC name: methyl (1S,4R)-4-aminocyclopent-2-ene-1-carboxylate. InChIKey: ANVYHALMQXHQSG-RITPCOANSA-N.
| Molecular formula | C7H11NO2 |
|---|---|
| Molecular weight | 141.17 g/mol |
| IUPAC name | methyl (1S,4R)-4-aminocyclopent-2-ene-1-carboxylate |
| InChIKey | ANVYHALMQXHQSG-RITPCOANSA-N |
| SMILES | COC(=O)[C@H]1C[C@H](C=C1)N |
Computed by PubChem (NCBI)