Products 1932330-08-9

CAS 1932330-08-9 is the registry number for Peramivir Impurity 22. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Methyl (1S,4S)-4-aminocyclopent-2-ene-1-carboxylate (CAS 1932330-08-9) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. IUPAC name: methyl (1S,4S)-4-aminocyclopent-2-ene-1-carboxylate. InChIKey: ANVYHALMQXHQSG-PHDIDXHHSA-N.

Identity
Molecular formulaC7H11NO2
Molecular weight141.17 g/mol
IUPAC namemethyl (1S,4S)-4-aminocyclopent-2-ene-1-carboxylate
InChIKeyANVYHALMQXHQSG-PHDIDXHHSA-N
SMILESCOC(=O)[C@H]1C[C@@H](C=C1)N

Computed by PubChem (NCBI)