CAS 1931900-80-9 is the registry number for Peramivir Impurity 21. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl (1R,4R)-4-aminocyclopent-2-ene-1-carboxylate (CAS 1931900-80-9) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. IUPAC name: methyl (1R,4R)-4-aminocyclopent-2-ene-1-carboxylate. InChIKey: ANVYHALMQXHQSG-WDSKDSINSA-N.
| Molecular formula | C7H11NO2 |
|---|---|
| Molecular weight | 141.17 g/mol |
| IUPAC name | methyl (1R,4R)-4-aminocyclopent-2-ene-1-carboxylate |
| InChIKey | ANVYHALMQXHQSG-WDSKDSINSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](C=C1)N |
Computed by PubChem (NCBI)