CAS 1389313-39-6 is the registry number for N-Boc-2-methyl-4-nitroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl N-(2-methyl-4-nitrophenyl)carbamate (CAS 1389313-39-6) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: tert-butyl N-(2-methyl-4-nitrophenyl)carbamate. InChIKey: ZFXOMQBRXHEGKO-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | tert-butyl N-(2-methyl-4-nitrophenyl)carbamate |
| InChIKey | ZFXOMQBRXHEGKO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)