CAS 1389859-88-4 is the registry number for (1R,3R)-3-(4-Bromophenyl)cyclohexane. Offered by: TRC. Available pack sizes: 500mg.
1-bromo-4-cyclohexylbenzene (CAS 1389859-88-4) is a chemical compound with the molecular formula C12H15Br and a molecular weight of 239.15 g/mol. IUPAC name: 1-bromo-4-cyclohexylbenzene. InChIKey: LVIJLEREXMVRAN-UHFFFAOYSA-N.
| Molecular formula | C12H15Br |
|---|---|
| Molecular weight | 239.15 g/mol |
| IUPAC name | 1-bromo-4-cyclohexylbenzene |
| InChIKey | LVIJLEREXMVRAN-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)