CAS 2730967-09-4 is the registry number for 6-Bromo-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene (CAS 2730967-09-4) is a chemical compound with the molecular formula C12H15Br and a molecular weight of 239.15 g/mol. IUPAC name: 6-bromo-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene. InChIKey: LLSVGDDKVGPWNH-UHFFFAOYSA-N.
| Molecular formula | C12H15Br |
|---|---|
| Molecular weight | 239.15 g/mol |
| IUPAC name | 6-bromo-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene |
| InChIKey | LLSVGDDKVGPWNH-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(CC1C)C=C(C=C2)Br |
Computed by PubChem (NCBI)