CAS 31006-99-2 is the registry number for 1-Bromo-4-(3,3-dimethylbut-1-en-2-yl)benzene 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-4-(3,3-dimethylbut-1-en-2-yl)benzene (CAS 31006-99-2) is a chemical compound with the molecular formula C12H15Br and a molecular weight of 239.15 g/mol. IUPAC name: 1-bromo-4-(3,3-dimethylbut-1-en-2-yl)benzene. InChIKey: YQJMYOLJEYZVLH-UHFFFAOYSA-N.
| Molecular formula | C12H15Br |
|---|---|
| Molecular weight | 239.15 g/mol |
| IUPAC name | 1-bromo-4-(3,3-dimethylbut-1-en-2-yl)benzene |
| InChIKey | YQJMYOLJEYZVLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=C)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)