CAS 1390654-76-8 appears in our catalog under these names: 6-Amino-2-(2-aminoethyl)-4-pyrimidinol dihydrochloride, 95%, 6-Amino-2-(2-aminoethyl)-4-pyrimidinol dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
4-amino-2-(2-aminoethyl)-1H-pyrimidin-6-one;dihydrochloride (CAS 1390654-76-8) is a chemical compound with the molecular formula C6H12Cl2N4O and a molecular weight of 227.09 g/mol. IUPAC name: 4-amino-2-(2-aminoethyl)-1H-pyrimidin-6-one;dihydrochloride. InChIKey: KCRMLZGWBRTPNX-UHFFFAOYSA-N.
| Molecular formula | C6H12Cl2N4O |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 4-amino-2-(2-aminoethyl)-1H-pyrimidin-6-one;dihydrochloride |
| InChIKey | KCRMLZGWBRTPNX-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(NC1=O)CCN)N.Cl.Cl |
Computed by PubChem (NCBI)