Products 2229558-64-7
CAS 2229558-64-7 is the registry number for 3-(Aminomethyl)-1-methyl-1H-pyrazole-5-carboxamide dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(aminomethyl)-1-methylpyrazole-5-carboxamide;dihydrochloride (CAS 2229558-64-7) is a chemical compound with the molecular formula C6H12Cl2N4O and a molecular weight of 227.09 g/mol. IUPAC name: 3-(aminomethyl)-1-methylpyrazole-5-carboxamide;dihydrochloride. InChIKey: HWTXAIVTABGOFI-UHFFFAOYSA-N.
| Molecular formula | C6H12Cl2N4O |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 3-(aminomethyl)-1-methylpyrazole-5-carboxamide;dihydrochloride |
| InChIKey | HWTXAIVTABGOFI-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)CN)C(=O)N.Cl.Cl |
Computed by PubChem (NCBI)