CAS 2219379-41-4 is the registry number for 2-(1H-1,2,4-Triazol-3-yl)morpholine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(1H-1,2,4-triazol-5-yl)morpholine;dihydrochloride (CAS 2219379-41-4) is a chemical compound with the molecular formula C6H12Cl2N4O and a molecular weight of 227.09 g/mol. IUPAC name: 2-(1H-1,2,4-triazol-5-yl)morpholine;dihydrochloride. InChIKey: UXLSERPTMCMOOI-UHFFFAOYSA-N.
| Molecular formula | C6H12Cl2N4O |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 2-(1H-1,2,4-triazol-5-yl)morpholine;dihydrochloride |
| InChIKey | UXLSERPTMCMOOI-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=NC=NN2.Cl.Cl |
Computed by PubChem (NCBI)